C17H17NO3S — CID 23886320
N-(1,3-benzodioxol-5-yl)-2-phenylsulfanylbutanamide (PubChem CID 23886320) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-phenylsulfanylbutanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 23886320 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-phenylsulfanylbutanamide |
| SMILES | CCC(Sc1ccccc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO3S/c1-2-16(22-13-6-4-3-5-7-13)17(19)18-12-8-9-14-15(10-12)21-11-20-14/h3-10,16H,2,11H2,1H3,(H,18,19) |
| InChIKey | JGKKVQGBSPSJQK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |