About 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid
2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid (PubChem CID 82572007) has the molecular formula C12H9NO4
and a molecular weight of 231.21 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid.
Analyze 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid?
The IUPAC name of 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid (CID 82572007) is 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid.
What is the SMILES notation for 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid?
The canonical SMILES for 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid is O=C(O)c1nccc2cc3c(cc12)OCCO3.
What is the InChIKey of 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid?
The InChIKey is JJVDTMLCHTWFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c14-12(15)11-8-6-10-9(16-3-4-17-10)5-7(8)1-2-13-11/h1-2,5-6H,3-4H2,(H,14,15).
What are the key properties of 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid?
2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid has a molecular weight of 231.21 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline-6-carboxylic acid is sourced from PubChem (CID 82572007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).