C15H15BrN2O2 — CID 106542870
6-(3-bromopyrrolidin-1-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline (PubChem CID 106542870) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 6-(3-bromopyrrolidin-1-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline.
| Compound Name | 6-(3-bromopyrrolidin-1-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 106542870 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 6-(3-bromopyrrolidin-1-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline |
| SMILES | BrC1CCN(c2nccc3cc4c(cc23)OCCO4)C1 |
| InChI | InChI=1S/C15H15BrN2O2/c16-11-2-4-18(9-11)15-12-8-14-13(19-5-6-20-14)7-10(12)1-3-17-15/h1,3,7-8,11H,2,4-6,9H2 |
| InChIKey | YCVGZIPARAPEFP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|