C15H8F3NO2 — CID 134841525
6-(trifluoromethyl)-[1,3]dioxolo[4,5-j]phenanthridine (PubChem CID 134841525) has the molecular formula C15H8F3NO2 and a molecular weight of 291.23 g/mol. Its IUPAC name is 6-(trifluoromethyl)-[1,3]dioxolo[4,5-j]phenanthridine.
| Compound Name | 6-(trifluoromethyl)-[1,3]dioxolo[4,5-j]phenanthridine |
|---|---|
| PubChem CID | 134841525 |
| Molecular Formula | C15H8F3NO2 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 6-(trifluoromethyl)-[1,3]dioxolo[4,5-j]phenanthridine |
| SMILES | FC(F)(F)c1nc2ccccc2c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H8F3NO2/c16-15(17,18)14-10-6-13-12(20-7-21-13)5-9(10)8-3-1-2-4-11(8)19-14/h1-6H,7H2 |
| InChIKey | LHWGFOWPXOIAEO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|