C16H10ClNO2 — CID 22503396
3-(1,3-benzodioxol-5-yl)-1-chloroisoquinoline (PubChem CID 22503396) has the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-chloroisoquinoline.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-chloroisoquinoline |
|---|---|
| PubChem CID | 22503396 |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-chloroisoquinoline |
| SMILES | Clc1nc(-c2ccc3c(c2)OCO3)cc2ccccc12 |
| InChI | InChI=1S/C16H10ClNO2/c17-16-12-4-2-1-3-10(12)7-13(18-16)11-5-6-14-15(8-11)20-9-19-14/h1-8H,9H2 |
| InChIKey | GWMPMFIAMYGTGW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|