C22H13Cl2NO2 — CID 8966777
2-(1,3-benzodioxol-5-yl)-6-chloro-4-(2-chlorophenyl)quinoline (PubChem CID 8966777) has the molecular formula C22H13Cl2NO2 and a molecular weight of 394.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-chloro-4-(2-chlorophenyl)quinoline.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-chloro-4-(2-chlorophenyl)quinoline |
|---|---|
| PubChem CID | 8966777 |
| Molecular Formula | C22H13Cl2NO2 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-chloro-4-(2-chlorophenyl)quinoline |
| SMILES | Clc1ccc2nc(-c3ccc4c(c3)OCO4)cc(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C22H13Cl2NO2/c23-14-6-7-19-17(10-14)16(15-3-1-2-4-18(15)24)11-20(25-19)13-5-8-21-22(9-13)27-12-26-21/h1-11H,12H2 |
| InChIKey | GMMYAIUMKJSTJY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |