C16H9N3O2 — CID 86211261
5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaene (PubChem CID 86211261) has the molecular formula C16H9N3O2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaene.
| Compound Name | 5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaene |
|---|---|
| PubChem CID | 86211261 |
| Molecular Formula | C16H9N3O2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaene |
| SMILES | c1ccc2c(c1)cnc1c3cc4c(cc3nnc21)OCO4 |
| InChI | InChI=1S/C16H9N3O2/c1-2-4-10-9(3-1)7-17-15-11-5-13-14(21-8-20-13)6-12(11)18-19-16(10)15/h1-7H,8H2 |
| InChIKey | WBIREJZZSUMVCR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|