C16H10N4O2 — CID 16764572
3-(1,3-benzodioxol-5-yl)-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 16764572) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 16764572 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | c1ccc2c(c1)cnn1c(-c3ccc4c(c3)OCO4)nnc21 |
| InChI | InChI=1S/C16H10N4O2/c1-2-4-12-11(3-1)8-17-20-15(18-19-16(12)20)10-5-6-13-14(7-10)22-9-21-13/h1-8H,9H2 |
| InChIKey | HMINEWYQSZKNCB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |