C12H12N2O3 — CID 134119166
2-(1,3-benzodioxol-5-yl)-1-hydroxy-4,5-dimethylimidazole (PubChem CID 134119166) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-hydroxy-4,5-dimethylimidazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-hydroxy-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 134119166 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-hydroxy-4,5-dimethylimidazole |
| SMILES | Cc1nc(-c2ccc3c(c2)OCO3)n(O)c1C |
| InChI | InChI=1S/C12H12N2O3/c1-7-8(2)14(15)12(13-7)9-3-4-10-11(5-9)17-6-16-10/h3-5,15H,6H2,1-2H3 |
| InChIKey | WDFWWKIPXOBIBS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|