C17H12N2O5 — CID 23505651
9-(1,3-benzodioxol-5-yl)-7-methyl-8-oxido-[1,3]dioxolo[4,5-f]quinazolin-8-ium (PubChem CID 23505651) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-7-methyl-8-oxido-[1,3]dioxolo[4,5-f]quinazolin-8-ium.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-7-methyl-8-oxido-[1,3]dioxolo[4,5-f]quinazolin-8-ium |
|---|---|
| PubChem CID | 23505651 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-7-methyl-8-oxido-[1,3]dioxolo[4,5-f]quinazolin-8-ium |
| SMILES | Cc1nc2ccc3c(c2c(-c2ccc4c(c2)OCO4)[n+]1[O-])OCO3 |
| InChI | InChI=1S/C17H12N2O5/c1-9-18-11-3-5-13-17(24-8-22-13)15(11)16(19(9)20)10-2-4-12-14(6-10)23-7-21-12/h2-6H,7-8H2,1H3 |
| InChIKey | IKCSPBJYGSYPAP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|