C11H10N2O3 — CID 102138218
6,8-dimethyl-7-oxido-[1,3]dioxolo[4,5-g]quinazolin-7-ium (PubChem CID 102138218) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 6,8-dimethyl-7-oxido-[1,3]dioxolo[4,5-g]quinazolin-7-ium.
| Compound Name | 6,8-dimethyl-7-oxido-[1,3]dioxolo[4,5-g]quinazolin-7-ium |
|---|---|
| PubChem CID | 102138218 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 6,8-dimethyl-7-oxido-[1,3]dioxolo[4,5-g]quinazolin-7-ium |
| SMILES | Cc1nc2cc3c(cc2c(C)[n+]1[O-])OCO3 |
| InChI | InChI=1S/C11H10N2O3/c1-6-8-3-10-11(16-5-15-10)4-9(8)12-7(2)13(6)14/h3-4H,5H2,1-2H3 |
| InChIKey | XDOWICIUYJAGQD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|