C20H14N4O4S2 — CID 13085991
6-methyl-8-[(6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-yl)disulfanyl]-[1,3]dioxolo[4,5-g]quinazoline (PubChem CID 13085991) has the molecular formula C20H14N4O4S2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 6-methyl-8-[(6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-yl)disulfanyl]-[1,3]dioxolo[4,5-g]quinazoline.
| Compound Name | 6-methyl-8-[(6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-yl)disulfanyl]-[1,3]dioxolo[4,5-g]quinazoline |
|---|---|
| PubChem CID | 13085991 |
| Molecular Formula | C20H14N4O4S2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 6-methyl-8-[(6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-yl)disulfanyl]-[1,3]dioxolo[4,5-g]quinazoline |
| SMILES | Cc1nc(SSc2nc(C)nc3cc4c(cc23)OCO4)c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C20H14N4O4S2/c1-9-21-13-5-17-15(25-7-27-17)3-11(13)19(23-9)29-30-20-12-4-16-18(28-8-26-16)6-14(12)22-10(2)24-20/h3-6H,7-8H2,1-2H3 |
| InChIKey | XJTNSMDHIKMDBD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|