C13H11NO4 — CID 2458135
6,8-dimethyl-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (PubChem CID 2458135) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 6,8-dimethyl-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid.
| Compound Name | 6,8-dimethyl-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 2458135 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 6,8-dimethyl-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| SMILES | Cc1nc2cc3c(cc2c(C)c1C(=O)O)OCO3 |
| InChI | InChI=1S/C13H11NO4/c1-6-8-3-10-11(18-5-17-10)4-9(8)14-7(2)12(6)13(15)16/h3-4H,5H2,1-2H3,(H,15,16) |
| InChIKey | FWYDDXQDQHZOCP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |