C12H12N2O2 — CID 84622210
N,8-dimethyl-[1,3]dioxolo[4,5-g]quinolin-6-amine (PubChem CID 84622210) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is N,8-dimethyl-[1,3]dioxolo[4,5-g]quinolin-6-amine.
| Compound Name | N,8-dimethyl-[1,3]dioxolo[4,5-g]quinolin-6-amine |
|---|---|
| PubChem CID | 84622210 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N,8-dimethyl-[1,3]dioxolo[4,5-g]quinolin-6-amine |
| SMILES | CNc1cc(C)c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C12H12N2O2/c1-7-3-12(13-2)14-9-5-11-10(4-8(7)9)15-6-16-11/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | CPFVBJIUNZAONF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |