C9H4Br2N2O2 — CID 133056890
6,7-dibromo-[1,3]dioxolo[4,5-g]quinoxaline (PubChem CID 133056890) has the molecular formula C9H4Br2N2O2 and a molecular weight of 331.95 g/mol. Its IUPAC name is 6,7-dibromo-[1,3]dioxolo[4,5-g]quinoxaline.
| Compound Name | 6,7-dibromo-[1,3]dioxolo[4,5-g]quinoxaline |
|---|---|
| PubChem CID | 133056890 |
| Molecular Formula | C9H4Br2N2O2 |
| Molecular Weight | 331.95 g/mol |
| Exact Mass | 329.86 |
| IUPAC Name | 6,7-dibromo-[1,3]dioxolo[4,5-g]quinoxaline |
| SMILES | Brc1nc2cc3c(cc2nc1Br)OCO3 |
| InChI | InChI=1S/C9H4Br2N2O2/c10-8-9(11)13-5-2-7-6(14-3-15-7)1-4(5)12-8/h1-2H,3H2 |
| InChIKey | BMWFSJRSYRLKHM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.95 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |