C13H12BrNO2 — CID 39403172
6-bromo-7-propan-2-yl-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 39403172) has the molecular formula C13H12BrNO2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 6-bromo-7-propan-2-yl-[1,3]dioxolo[4,5-g]quinoline.
| Compound Name | 6-bromo-7-propan-2-yl-[1,3]dioxolo[4,5-g]quinoline |
|---|---|
| PubChem CID | 39403172 |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 6-bromo-7-propan-2-yl-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | CC(C)c1cc2cc3c(cc2nc1Br)OCO3 |
| InChI | InChI=1S/C13H12BrNO2/c1-7(2)9-3-8-4-11-12(17-6-16-11)5-10(8)15-13(9)14/h3-5,7H,6H2,1-2H3 |
| InChIKey | QMMGRSLNTRZXOO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|