C17H18BrNO2 — CID 43393522
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-propan-2-ylaniline (PubChem CID 43393522) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-propan-2-ylaniline.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-propan-2-ylaniline |
|---|---|
| PubChem CID | 43393522 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-propan-2-ylaniline |
| SMILES | CC(C)c1ccccc1NCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C17H18BrNO2/c1-11(2)13-5-3-4-6-15(13)19-9-12-7-16-17(8-14(12)18)21-10-20-16/h3-8,11,19H,9-10H2,1-2H3 |
| InChIKey | AMULJPQHDATVSV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |