C19H25N — CID 43759441
2-propan-2-yl-N-[(2,4,5-trimethylphenyl)methyl]aniline (PubChem CID 43759441) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-propan-2-yl-N-[(2,4,5-trimethylphenyl)methyl]aniline.
| Compound Name | 2-propan-2-yl-N-[(2,4,5-trimethylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 43759441 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-propan-2-yl-N-[(2,4,5-trimethylphenyl)methyl]aniline |
| SMILES | Cc1cc(C)c(CNc2ccccc2C(C)C)cc1C |
| InChI | InChI=1S/C19H25N/c1-13(2)18-8-6-7-9-19(18)20-12-17-11-15(4)14(3)10-16(17)5/h6-11,13,20H,12H2,1-5H3 |
| InChIKey | SEZVGLWTZYVXOG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |