C20H29ClN2 — CID 158304754
N,N'-bis(2-propan-2-ylphenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 158304754) has the molecular formula C20H29ClN2 and a molecular weight of 332.92 g/mol. Its IUPAC name is N,N'-bis(2-propan-2-ylphenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N,N'-bis(2-propan-2-ylphenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 158304754 |
| Molecular Formula | C20H29ClN2 |
| Molecular Weight | 332.92 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | N,N'-bis(2-propan-2-ylphenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | CC(C)c1ccccc1NCCNc1ccccc1C(C)C.Cl |
| InChI | InChI=1S/C20H28N2.ClH/c1-15(2)17-9-5-7-11-19(17)21-13-14-22-20-12-8-6-10-18(20)16(3)4;/h5-12,15-16,21-22H,13-14H2,1-4H3;1H |
| InChIKey | GMYCAOQAYOVXKE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|