C18H23ClN2 — CID 54807478
N-(3-chloro-2-methylphenyl)-N'-(2-propan-2-ylphenyl)ethane-1,2-diamine (PubChem CID 54807478) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-(2-propan-2-ylphenyl)ethane-1,2-diamine.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-(2-propan-2-ylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54807478 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-(2-propan-2-ylphenyl)ethane-1,2-diamine |
| SMILES | Cc1c(Cl)cccc1NCCNc1ccccc1C(C)C |
| InChI | InChI=1S/C18H23ClN2/c1-13(2)15-7-4-5-9-18(15)21-12-11-20-17-10-6-8-16(19)14(17)3/h4-10,13,20-21H,11-12H2,1-3H3 |
| InChIKey | JMRPYAGCQSEQPY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|