C18H20N2 — CID 107803442
2-methyl-6-[(2,4,5-trimethylphenyl)methylamino]benzonitrile (PubChem CID 107803442) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-methyl-6-[(2,4,5-trimethylphenyl)methylamino]benzonitrile.
| Compound Name | 2-methyl-6-[(2,4,5-trimethylphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 107803442 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-methyl-6-[(2,4,5-trimethylphenyl)methylamino]benzonitrile |
| SMILES | Cc1cc(C)c(CNc2cccc(C)c2C#N)cc1C |
| InChI | InChI=1S/C18H20N2/c1-12-6-5-7-18(17(12)10-19)20-11-16-9-14(3)13(2)8-15(16)4/h5-9,20H,11H2,1-4H3 |
| InChIKey | WDXKALKIEVRCQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |