C15H12F2N2 — CID 107802943
2-[(3,5-difluorophenyl)methylamino]-6-methylbenzonitrile (PubChem CID 107802943) has the molecular formula C15H12F2N2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methylamino]-6-methylbenzonitrile.
| Compound Name | 2-[(3,5-difluorophenyl)methylamino]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 107802943 |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methylamino]-6-methylbenzonitrile |
| SMILES | Cc1cccc(NCc2cc(F)cc(F)c2)c1C#N |
| InChI | InChI=1S/C15H12F2N2/c1-10-3-2-4-15(14(10)8-18)19-9-11-5-12(16)7-13(17)6-11/h2-7,19H,9H2,1H3 |
| InChIKey | NXDOEZDWUHKZRP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |