C16H16BrNO2S — CID 63453308
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfanylaniline (PubChem CID 63453308) has the molecular formula C16H16BrNO2S and a molecular weight of 366.28 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfanylaniline.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfanylaniline |
|---|---|
| PubChem CID | 63453308 |
| Molecular Formula | C16H16BrNO2S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfanylaniline |
| SMILES | CCSc1ccccc1NCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C16H16BrNO2S/c1-2-21-16-6-4-3-5-13(16)18-9-11-7-14-15(8-12(11)17)20-10-19-14/h3-8,18H,2,9-10H2,1H3 |
| InChIKey | CMEVQQIVEVRHBM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |