C15H12BrN3O2 — CID 43731054
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-1H-indazol-7-amine (PubChem CID 43731054) has the molecular formula C15H12BrN3O2 and a molecular weight of 346.18 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-1H-indazol-7-amine.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-1H-indazol-7-amine |
|---|---|
| PubChem CID | 43731054 |
| Molecular Formula | C15H12BrN3O2 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-1H-indazol-7-amine |
| SMILES | Brc1cc2c(cc1CNc1cccc3cn[nH]c13)OCO2 |
| InChI | InChI=1S/C15H12BrN3O2/c16-11-5-14-13(20-8-21-14)4-10(11)6-17-12-3-1-2-9-7-18-19-15(9)12/h1-5,7,17H,6,8H2,(H,18,19) |
| InChIKey | QVOWHUBEBXSOQH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |