C17H14N4O4 — CID 36575892
N-[2-(1H-indazol-7-ylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 36575892) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is N-[2-(1H-indazol-7-ylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(1H-indazol-7-ylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 36575892 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[2-(1H-indazol-7-ylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C17H14N4O4/c22-15(20-12-3-1-2-11-7-19-21-16(11)12)8-18-17(23)10-4-5-13-14(6-10)25-9-24-13/h1-7H,8-9H2,(H,18,23)(H,19,21)(H,20,22) |
| InChIKey | WDKBSBNCGPWWQG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |