C15H13F2N3O — CID 43730919
N-[[2-(difluoromethoxy)phenyl]methyl]-1H-indazol-7-amine (PubChem CID 43730919) has the molecular formula C15H13F2N3O and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-1H-indazol-7-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1H-indazol-7-amine |
|---|---|
| PubChem CID | 43730919 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1H-indazol-7-amine |
| SMILES | FC(F)Oc1ccccc1CNc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C15H13F2N3O/c16-15(17)21-13-7-2-1-4-10(13)8-18-12-6-3-5-11-9-19-20-14(11)12/h1-7,9,15,18H,8H2,(H,19,20) |
| InChIKey | SIJLIZHGEDAQGX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |