C12H13F2N3O3S — CID 60912231
N-[[2-(difluoromethoxy)phenyl]methyl]-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 60912231) has the molecular formula C12H13F2N3O3S and a molecular weight of 317.32 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60912231 |
| Molecular Formula | C12H13F2N3O3S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C12H13F2N3O3S/c1-8-11(7-15-17-8)21(18,19)16-6-9-4-2-3-5-10(9)20-12(13)14/h2-5,7,12,16H,6H2,1H3,(H,15,17) |
| InChIKey | NVAILYVXIXRUAB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |