C10H14N4O2S — CID 103710703
5-methyl-N-[(1-methylpyrrol-2-yl)methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 103710703) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 5-methyl-N-[(1-methylpyrrol-2-yl)methyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-[(1-methylpyrrol-2-yl)methyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 103710703 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-methyl-N-[(1-methylpyrrol-2-yl)methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCc1cccn1C |
| InChI | InChI=1S/C10H14N4O2S/c1-8-10(7-11-13-8)17(15,16)12-6-9-4-3-5-14(9)2/h3-5,7,12H,6H2,1-2H3,(H,11,13) |
| InChIKey | KQTILFUKPFHGHS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |