C10H9F3N4O2S — CID 155936731
8-methyl-11-(trifluoromethyl)-7λ6-thia-3,4,8,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,11-tetraene 7,7-dioxide (PubChem CID 155936731) has the molecular formula C10H9F3N4O2S and a molecular weight of 306.27 g/mol. Its IUPAC name is 8-methyl-11-(trifluoromethyl)-7λ6-thia-3,4,8,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,11-tetraene 7,7-dioxide.
| Compound Name | 8-methyl-11-(trifluoromethyl)-7λ6-thia-3,4,8,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,11-tetraene 7,7-dioxide |
|---|---|
| PubChem CID | 155936731 |
| Molecular Formula | C10H9F3N4O2S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 8-methyl-11-(trifluoromethyl)-7λ6-thia-3,4,8,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,11-tetraene 7,7-dioxide |
| SMILES | CN1Cn2c(ccc2C(F)(F)F)-c2[nH]ncc2S1(=O)=O |
| InChI | InChI=1S/C10H9F3N4O2S/c1-16-5-17-6(2-3-8(17)10(11,12)13)9-7(4-14-15-9)20(16,18)19/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | NQXOOCPASUUKSY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |