C20H19N3O3 — CID 95146466
2-[[(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]phthalazin-1-one (PubChem CID 95146466) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[[(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]phthalazin-1-one.
| Compound Name | 2-[[(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]phthalazin-1-one |
|---|---|
| PubChem CID | 95146466 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[[(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2cnn1CN1CCC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19N3O3/c24-20-16-5-2-1-4-15(16)11-21-23(20)12-22-9-3-6-17(22)14-7-8-18-19(10-14)26-13-25-18/h1-2,4-5,7-8,10-11,17H,3,6,9,12-13H2/t17-/m0/s1 |
| InChIKey | RXWHSZLLRNVZSO-KRWDZBQOSA-N |
| XLogP | 2.92 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |