C19H19N3O2 — CID 127720385
6-[[2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]-1H-indazole (PubChem CID 127720385) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-[[2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]-1H-indazole.
| Compound Name | 6-[[2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]-1H-indazole |
|---|---|
| PubChem CID | 127720385 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 6-[[2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]methyl]-1H-indazole |
| SMILES | c1cc2cn[nH]c2cc1CN1CCCC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19N3O2/c1-2-17(14-5-6-18-19(9-14)24-12-23-18)22(7-1)11-13-3-4-15-10-20-21-16(15)8-13/h3-6,8-10,17H,1-2,7,11-12H2,(H,20,21) |
| InChIKey | FNJVGAGZDPFONW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |