C12H13NO2 — CID 10954648
5-ethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 10954648) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-ethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-ethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 10954648 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-ethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | CCC1=NCCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C12H13NO2/c1-2-10-9-6-12-11(14-7-15-12)5-8(9)3-4-13-10/h5-6H,2-4,7H2,1H3 |
| InChIKey | WPVXRORROLQZEX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |