About 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride
7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride (PubChem CID 12557876) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride |
| PubChem CID | 12557876 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride |
| SMILES | C1=NCCc2cc3c(cc21)OCO3.Cl |
| InChI | InChI=1S/C10H9NO2.ClH/c1-2-11-5-8-4-10-9(3-7(1)8)12-6-13-10;/h3-5H,1-2,6H2;1H |
| InChIKey | RTIDGRMONMNKDR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride?
The IUPAC name of 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride (CID 12557876) is 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride.
What is the SMILES notation for 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride?
The canonical SMILES for 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride is C1=NCCc2cc3c(cc21)OCO3.Cl.
What is the InChIKey of 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride?
The InChIKey is RTIDGRMONMNKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.ClH/c1-2-11-5-8-4-10-9(3-7(1)8)12-6-13-10;/h3-5H,1-2,6H2;1H.
What are the key properties of 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride?
7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride has a molecular weight of 211.65 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride is sourced from PubChem (CID 12557876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).