C10H11NO2 — CID 168797077
5,5,6,7,7-pentadeuteriocyclopenta[f][1,3]benzodioxol-6-amine (PubChem CID 168797077) has the molecular formula C10H11NO2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 5,5,6,7,7-pentadeuteriocyclopenta[f][1,3]benzodioxol-6-amine.
| Compound Name | 5,5,6,7,7-pentadeuteriocyclopenta[f][1,3]benzodioxol-6-amine |
|---|---|
| PubChem CID | 168797077 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 5,5,6,7,7-pentadeuteriocyclopenta[f][1,3]benzodioxol-6-amine |
| SMILES | [2H]C1([2H])c2cc3c(cc2C([2H])([2H])C1([2H])N)OCO3 |
| InChI | InChI=1S/C10H11NO2/c11-8-1-6-3-9-10(13-5-12-9)4-7(6)2-8/h3-4,8H,1-2,5,11H2/i1D2,2D2,8D |
| InChIKey | FQDRMHHCWZAXJM-YAJIPLGWSA-N |
| XLogP | 0.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |