C10H10N2O3 — CID 121215736
6-amino-5,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-7-one (PubChem CID 121215736) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 6-amino-5,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-7-one.
| Compound Name | 6-amino-5,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-7-one |
|---|---|
| PubChem CID | 121215736 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 6-amino-5,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-7-one |
| SMILES | NN1Cc2cc3c(cc2CC1=O)OCO3 |
| InChI | InChI=1S/C10H10N2O3/c11-12-4-7-2-9-8(14-5-15-9)1-6(7)3-10(12)13/h1-2H,3-5,11H2 |
| InChIKey | GZHOGMADCQKYOJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|