C16H17NO4 — CID 102210969
(1R)-5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-2,4(8),9-triene-13,17-dione (PubChem CID 102210969) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (1R)-5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-2,4(8),9-triene-13,17-dione.
| Compound Name | (1R)-5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-2,4(8),9-triene-13,17-dione |
|---|---|
| PubChem CID | 102210969 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (1R)-5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-2,4(8),9-triene-13,17-dione |
| SMILES | O=C1CCCC(=O)N2CC[C@@H]1c1cc3c(cc1C2)OCO3 |
| InChI | InChI=1S/C16H17NO4/c18-13-2-1-3-16(19)17-5-4-11(13)12-7-15-14(20-9-21-15)6-10(12)8-17/h6-7,11H,1-5,8-9H2/t11-/m1/s1 |
| InChIKey | ZSUWKYKLNFOKJY-LLVKDONJSA-N |
| XLogP | 1.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |