C19H21NO6 — CID 11681976
(1R,14S,18R,19S,21S)-16,16-dimethyl-5,7,15,17,20-pentaoxa-12-azahexacyclo[10.9.2.02,10.04,8.014,18.019,21]tricosa-2,4(8),9-trien-13-one (PubChem CID 11681976) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is (1R,14S,18R,19S,21S)-16,16-dimethyl-5,7,15,17,20-pentaoxa-12-azahexacyclo[10.9.2.02,10.04,8.014,18.019,21]tricosa-2,4(8),9-trien-13-one.
| Compound Name | (1R,14S,18R,19S,21S)-16,16-dimethyl-5,7,15,17,20-pentaoxa-12-azahexacyclo[10.9.2.02,10.04,8.014,18.019,21]tricosa-2,4(8),9-trien-13-one |
|---|---|
| PubChem CID | 11681976 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (1R,14S,18R,19S,21S)-16,16-dimethyl-5,7,15,17,20-pentaoxa-12-azahexacyclo[10.9.2.02,10.04,8.014,18.019,21]tricosa-2,4(8),9-trien-13-one |
| SMILES | CC1(C)O[C@@H]2[C@H]3O[C@H]3[C@@H]3CCN(Cc4cc5c(cc43)OCO5)C(=O)[C@H]2O1 |
| InChI | InChI=1S/C19H21NO6/c1-19(2)25-16-15-14(24-15)10-3-4-20(18(21)17(16)26-19)7-9-5-12-13(6-11(9)10)23-8-22-12/h5-6,10,14-17H,3-4,7-8H2,1-2H3/t10-,14+,15+,16-,17+/m1/s1 |
| InChIKey | SJRMXWUQODOTBJ-BDNDHPQMSA-N |
| XLogP | 1.53 |
| TPSA | 69.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|