C17H17N3O7 — CID 11268847
(2R,3R,4S,8R,9S,10R)-3-azido-9-hydroxy-6,6-dimethyl-5,7,11,16,18-pentaoxapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one (PubChem CID 11268847) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is (2R,3R,4S,8R,9S,10R)-3-azido-9-hydroxy-6,6-dimethyl-5,7,11,16,18-pentaoxapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one.
| Compound Name | (2R,3R,4S,8R,9S,10R)-3-azido-9-hydroxy-6,6-dimethyl-5,7,11,16,18-pentaoxapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one |
|---|---|
| PubChem CID | 11268847 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (2R,3R,4S,8R,9S,10R)-3-azido-9-hydroxy-6,6-dimethyl-5,7,11,16,18-pentaoxapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O)[C@@H]3OC(=O)c4cc5c(cc4[C@@H]3[C@@H](N=[N+]=[N-])[C@@H]2O1)OCO5 |
| InChI | InChI=1S/C17H17N3O7/c1-17(2)26-14-11(19-20-18)10-6-3-8-9(24-5-23-8)4-7(6)16(22)25-13(10)12(21)15(14)27-17/h3-4,10-15,21H,5H2,1-2H3/t10-,11-,12+,13-,14+,15-/m1/s1 |
| InChIKey | KQMBPQGIERARLL-JSLGZRHDSA-N |
| XLogP | 1.61 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|