C19H21NO9 — CID 139091949
(2S,3S,7S,9S,10R)-9-hydroxy-4-methyl-11,16,18-trioxa-4-azoniapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),13,15(19)-trien-12-one;2-hydroxy-2-oxoacetate (PubChem CID 139091949) has the molecular formula C19H21NO9 and a molecular weight of 407.38 g/mol. Its IUPAC name is (2S,3S,7S,9S,10R)-9-hydroxy-4-methyl-11,16,18-trioxa-4-azoniapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),13,15(19)-trien-12-one;2-hydroxy-2-oxoacetate.
| Compound Name | (2S,3S,7S,9S,10R)-9-hydroxy-4-methyl-11,16,18-trioxa-4-azoniapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),13,15(19)-trien-12-one;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 139091949 |
| Molecular Formula | C19H21NO9 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (2S,3S,7S,9S,10R)-9-hydroxy-4-methyl-11,16,18-trioxa-4-azoniapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),13,15(19)-trien-12-one;2-hydroxy-2-oxoacetate |
| SMILES | C[NH+]1CC[C@H]2C[C@H](O)[C@@H]3OC(=O)c4cc5c(cc4[C@H]3[C@H]21)OCO5.O=C([O-])C(=O)O |
| InChI | InChI=1S/C17H19NO5.C2H2O4/c1-18-3-2-8-4-11(19)16-14(15(8)18)9-5-12-13(22-7-21-12)6-10(9)17(20)23-16;3-1(4)2(5)6/h5-6,8,11,14-16,19H,2-4,7H2,1H3;(H,3,4)(H,5,6)/t8-,11-,14-,15-,16-;/m0./s1 |
| InChIKey | TXSHMTHYBHKKKW-BKJGCIOBSA-N |
| XLogP | -2.47 |
| TPSA | 146.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|