C15H17N3O5 — CID 101360646
methyl (3aS,4R,5S,9bR)-5-azido-4-hydroxy-2,2-dimethyl-3a,4,5,9b-tetrahydrobenzo[e][1,3]benzodioxole-8-carboxylate (PubChem CID 101360646) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl (3aS,4R,5S,9bR)-5-azido-4-hydroxy-2,2-dimethyl-3a,4,5,9b-tetrahydrobenzo[e][1,3]benzodioxole-8-carboxylate.
| Compound Name | methyl (3aS,4R,5S,9bR)-5-azido-4-hydroxy-2,2-dimethyl-3a,4,5,9b-tetrahydrobenzo[e][1,3]benzodioxole-8-carboxylate |
|---|---|
| PubChem CID | 101360646 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl (3aS,4R,5S,9bR)-5-azido-4-hydroxy-2,2-dimethyl-3a,4,5,9b-tetrahydrobenzo[e][1,3]benzodioxole-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C15H17N3O5/c1-15(2)22-12-9-6-7(14(20)21-3)4-5-8(9)10(17-18-16)11(19)13(12)23-15/h4-6,10-13,19H,1-3H3/t10-,11+,12+,13-/m0/s1 |
| InChIKey | AGSSKSVKKSZBHM-LOWDOPEQSA-N |
| XLogP | 2.39 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|