C15H16O5 — CID 101360645
methyl (2R,4R,5R,9R)-7,7-dimethyl-3,6,8-trioxatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),11,13-triene-12-carboxylate (PubChem CID 101360645) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl (2R,4R,5R,9R)-7,7-dimethyl-3,6,8-trioxatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),11,13-triene-12-carboxylate.
| Compound Name | methyl (2R,4R,5R,9R)-7,7-dimethyl-3,6,8-trioxatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),11,13-triene-12-carboxylate |
|---|---|
| PubChem CID | 101360645 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl (2R,4R,5R,9R)-7,7-dimethyl-3,6,8-trioxatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),11,13-triene-12-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H]1OC(C)(C)O[C@H]1[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C15H16O5/c1-15(2)19-11-9-6-7(14(16)17-3)4-5-8(9)10-12(18-10)13(11)20-15/h4-6,10-13H,1-3H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | BVHIETWJPALOEY-FDYHWXHSSA-N |
| XLogP | 2.12 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|