C21H24O9 — CID 11112587
ethyl (1R,2R,6R,8S,10R)-10-[(4-methoxycarbonylphenyl)methyl]-4,4-dimethyl-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate (PubChem CID 11112587) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is ethyl (1R,2R,6R,8S,10R)-10-[(4-methoxycarbonylphenyl)methyl]-4,4-dimethyl-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate.
| Compound Name | ethyl (1R,2R,6R,8S,10R)-10-[(4-methoxycarbonylphenyl)methyl]-4,4-dimethyl-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
|---|---|
| PubChem CID | 11112587 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | ethyl (1R,2R,6R,8S,10R)-10-[(4-methoxycarbonylphenyl)methyl]-4,4-dimethyl-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccc(C(=O)OC)cc2)O[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2C1=O |
| InChI | InChI=1S/C21H24O9/c1-5-26-19(24)21(10-11-6-8-12(9-7-11)17(23)25-4)16(22)14-13(29-21)15-18(27-14)30-20(2,3)28-15/h6-9,13-15,18H,5,10H2,1-4H3/t13-,14-,15+,18+,21+/m0/s1 |
| InChIKey | RAVJMVMVWWEFPD-KCQOQIFASA-N |
| XLogP | 1.16 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|