C19H21NO9 — CID 10884033
ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-10-[(4-nitrophenyl)methyl]-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate (PubChem CID 10884033) has the molecular formula C19H21NO9 and a molecular weight of 407.38 g/mol. Its IUPAC name is ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-10-[(4-nitrophenyl)methyl]-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate.
| Compound Name | ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-10-[(4-nitrophenyl)methyl]-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
|---|---|
| PubChem CID | 10884033 |
| Molecular Formula | C19H21NO9 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-10-[(4-nitrophenyl)methyl]-9-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccc([N+](=O)[O-])cc2)O[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2C1=O |
| InChI | InChI=1S/C19H21NO9/c1-4-25-17(22)19(9-10-5-7-11(8-6-10)20(23)24)15(21)13-12(28-19)14-16(26-13)29-18(2,3)27-14/h5-8,12-14,16H,4,9H2,1-3H3/t12-,13-,14+,16+,19+/m0/s1 |
| InChIKey | ZTTAWRJICKILIL-ULMOPWMKSA-N |
| XLogP | 1.28 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|