C16H19NO8 — CID 66742152
(4-nitrophenyl) (3aR,5R,6S,6aR)-5-ethyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate (PubChem CID 66742152) has the molecular formula C16H19NO8 and a molecular weight of 353.33 g/mol. Its IUPAC name is (4-nitrophenyl) (3aR,5R,6S,6aR)-5-ethyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate.
| Compound Name | (4-nitrophenyl) (3aR,5R,6S,6aR)-5-ethyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 66742152 |
| Molecular Formula | C16H19NO8 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (4-nitrophenyl) (3aR,5R,6S,6aR)-5-ethyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate |
| SMILES | CC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@]1(O)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19NO8/c1-4-11-16(19,12-13(23-11)25-15(2,3)24-12)14(18)22-10-7-5-9(6-8-10)17(20)21/h5-8,11-13,19H,4H2,1-3H3/t11-,12+,13-,16+/m1/s1 |
| InChIKey | JHWVCWRUKGVJGQ-IATRGZMQSA-N |
| XLogP | 1.52 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|