C19H18N2O8 — CID 135069192
ethyl (2R,4S,5R)-4-methyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate (PubChem CID 135069192) has the molecular formula C19H18N2O8 and a molecular weight of 402.36 g/mol. Its IUPAC name is ethyl (2R,4S,5R)-4-methyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl (2R,4S,5R)-4-methyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 135069192 |
| Molecular Formula | C19H18N2O8 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | ethyl (2R,4S,5R)-4-methyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)O[C@H](c2ccc([N+](=O)[O-])cc2)O[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N2O8/c1-3-27-18(22)19(2)16(12-4-8-14(9-5-12)20(23)24)28-17(29-19)13-6-10-15(11-7-13)21(25)26/h4-11,16-17H,3H2,1-2H3/t16-,17-,19+/m1/s1 |
| InChIKey | FTMQNNRPVVNZGO-LMMKCTJWSA-N |
| XLogP | 3.61 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|