C27H26N2O8 — CID 24806586
tert-butyl (2R,4R,5R)-4-benzyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate (PubChem CID 24806586) has the molecular formula C27H26N2O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is tert-butyl (2R,4R,5R)-4-benzyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate.
| Compound Name | tert-butyl (2R,4R,5R)-4-benzyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 24806586 |
| Molecular Formula | C27H26N2O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | tert-butyl (2R,4R,5R)-4-benzyl-2,5-bis(4-nitrophenyl)-1,3-dioxolane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(Cc2ccccc2)O[C@H](c2ccc([N+](=O)[O-])cc2)O[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26N2O8/c1-26(2,3)37-25(30)27(17-18-7-5-4-6-8-18)23(19-9-13-21(14-10-19)28(31)32)35-24(36-27)20-11-15-22(16-12-20)29(33)34/h4-16,23-24H,17H2,1-3H3/t23-,24-,27-/m1/s1 |
| InChIKey | KPORUYUVQKCEJV-FKCDAAJZSA-N |
| XLogP | 5.61 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|