C25H26N2O8 — CID 71734645
ethyl (2S,3S,4S,5R)-2-benzyl-3-methyl-5-(4-nitrophenyl)-4-(2-oxo-1,3-oxazolidine-3-carbonyl)oxolane-2-carboxylate (PubChem CID 71734645) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is ethyl (2S,3S,4S,5R)-2-benzyl-3-methyl-5-(4-nitrophenyl)-4-(2-oxo-1,3-oxazolidine-3-carbonyl)oxolane-2-carboxylate.
| Compound Name | ethyl (2S,3S,4S,5R)-2-benzyl-3-methyl-5-(4-nitrophenyl)-4-(2-oxo-1,3-oxazolidine-3-carbonyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 71734645 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | ethyl (2S,3S,4S,5R)-2-benzyl-3-methyl-5-(4-nitrophenyl)-4-(2-oxo-1,3-oxazolidine-3-carbonyl)oxolane-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2)O[C@@H](c2ccc([N+](=O)[O-])cc2)[C@@H](C(=O)N2CCOC2=O)[C@@H]1C |
| InChI | InChI=1S/C25H26N2O8/c1-3-33-23(29)25(15-17-7-5-4-6-8-17)16(2)20(22(28)26-13-14-34-24(26)30)21(35-25)18-9-11-19(12-10-18)27(31)32/h4-12,16,20-21H,3,13-15H2,1-2H3/t16-,20-,21-,25-/m0/s1 |
| InChIKey | DUGNXTVWEZZTAR-NQOWGVLHSA-N |
| XLogP | 3.44 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|