C26H29N3O9 — CID 102100917
dimethyl (3R,5R)-3-benzyl-5-[(S)-(2-methylpropan-2-yl)oxycarbonyloxy-(4-nitrophenyl)methyl]-4H-pyrazole-3,5-dicarboxylate (PubChem CID 102100917) has the molecular formula C26H29N3O9 and a molecular weight of 527.53 g/mol. Its IUPAC name is dimethyl (3R,5R)-3-benzyl-5-[(S)-(2-methylpropan-2-yl)oxycarbonyloxy-(4-nitrophenyl)methyl]-4H-pyrazole-3,5-dicarboxylate.
| Compound Name | dimethyl (3R,5R)-3-benzyl-5-[(S)-(2-methylpropan-2-yl)oxycarbonyloxy-(4-nitrophenyl)methyl]-4H-pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 102100917 |
| Molecular Formula | C26H29N3O9 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | dimethyl (3R,5R)-3-benzyl-5-[(S)-(2-methylpropan-2-yl)oxycarbonyloxy-(4-nitrophenyl)methyl]-4H-pyrazole-3,5-dicarboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccccc2)C[C@](C(=O)OC)([C@@H](OC(=O)OC(C)(C)C)c2ccc([N+](=O)[O-])cc2)N=N1 |
| InChI | InChI=1S/C26H29N3O9/c1-24(2,3)38-23(32)37-20(18-11-13-19(14-12-18)29(33)34)26(22(31)36-5)16-25(27-28-26,21(30)35-4)15-17-9-7-6-8-10-17/h6-14,20H,15-16H2,1-5H3/t20-,25+,26+/m0/s1 |
| InChIKey | RJRXMGMQCZGHMO-GKBBYZSKSA-N |
| XLogP | 4.51 |
| TPSA | 155.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|