C23H19NO4 — CID 101031531
cis-methyl (1S,2S)-2-(4-nitrophenyl)-1,2-diphenylcyclopropane-1-carboxylate (PubChem CID 101031531) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-(4-nitrophenyl)-1,2-diphenylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2S)-2-(4-nitrophenyl)-1,2-diphenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101031531 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | cis-methyl (1S,2S)-2-(4-nitrophenyl)-1,2-diphenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)C[C@]1(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19NO4/c1-28-21(25)23(18-10-6-3-7-11-18)16-22(23,17-8-4-2-5-9-17)19-12-14-20(15-13-19)24(26)27/h2-15H,16H2,1H3/t22-,23+/m0/s1 |
| InChIKey | WQABOLYKVQAHGO-XZOQPEGZSA-N |
| XLogP | 4.40 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|