C28H28N2O5 — CID 71653358
tert-butyl (2R,3S)-1-benzyl-3-methyl-6-nitro-4-oxo-2-phenyl-2H-quinoline-3-carboxylate (PubChem CID 71653358) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is tert-butyl (2R,3S)-1-benzyl-3-methyl-6-nitro-4-oxo-2-phenyl-2H-quinoline-3-carboxylate.
| Compound Name | tert-butyl (2R,3S)-1-benzyl-3-methyl-6-nitro-4-oxo-2-phenyl-2H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 71653358 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | tert-butyl (2R,3S)-1-benzyl-3-methyl-6-nitro-4-oxo-2-phenyl-2H-quinoline-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(C)C(=O)c2cc([N+](=O)[O-])ccc2N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H28N2O5/c1-27(2,3)35-26(32)28(4)24(20-13-9-6-10-14-20)29(18-19-11-7-5-8-12-19)23-16-15-21(30(33)34)17-22(23)25(28)31/h5-17,24H,18H2,1-4H3/t24-,28+/m1/s1 |
| InChIKey | UZTMLMXGHDATPT-YWEHKCAJSA-N |
| XLogP | 5.89 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|